Compound Q&A

How should 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) be stored?

Answer

3,5-Dichlorobenzoyl chloride
3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) should be stored in a cool, dry place (15-25°C), away from light and moisture. Use airtight, corrosion-resistant containers such as glass or stainless steel. Ensure proper ventilation to prevent vapor accumulation, and keep it separate from incompatible materials like strong bases or reducing agents to maintain stability.

About

CAS No 2905-62-6
English Name 3,5-Dichlorobenzoyl chloride
Molecular Formula C7H3Cl3O
Molecular Weight 209.46 g/mol
SMILES C1=C(C=C(C=C1Cl)Cl)C(=O)Cl
InChIKey GGHLXLVPNZMBQR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6)?

3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) is a chlorinated aromatic compound with the molecular ...

Compound Q&A

What are the main uses of 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6)?

3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) is primarily used in pharmaceuticals for synthesizing ...

Compound Q&A

Is 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) safe?

3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) requires careful handling due to its potential to caus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...