Compound Q&A

What are the main uses of 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6)?

Answer

3,5-Dichlorobenzoyl chloride
3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) is primarily used in pharmaceuticals for synthesizing active drug compounds, in industrial applications for producing dyes and pesticides, and in research for creating functionalized materials. Its reactivity makes it valuable in chemical reactions involving acylation and chlorination, contributing to the development of various chemical products.

About

CAS No 2905-62-6
English Name 3,5-Dichlorobenzoyl chloride
Molecular Formula C7H3Cl3O
Molecular Weight 209.46 g/mol
SMILES C1=C(C=C(C=C1Cl)Cl)C(=O)Cl
InChIKey GGHLXLVPNZMBQR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6)?

3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) is a chlorinated aromatic compound with the molecular ...

Compound Q&A

Is 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) safe?

3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) requires careful handling due to its potential to caus...

Compound Q&A

How should 3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) be stored?

3,5-Dichlorobenzoyl chloride (CAS: 2905-62-6) should be stored in a cool, dry place (15-25°C), away ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...