Compound Q&A

What are the main uses of 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3)?

Answer

3-Amino-4-hydroxybenzenesulfonic acid
3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) is primarily used in pharmaceuticals as a precursor for drugs like sulfa medications. It also finds applications in the dye industry for producing azo dyes and in research for synthesizing other organic compounds. Additionally, it may be used in some food-related applications as a stabilizer or preservative.

About

CAS No 98-37-3
English Name 3-Amino-4-hydroxybenzenesulfonic acid
Molecular Formula C6H7NO4S
Molecular Weight 189.19 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)O
InChIKey ULUIMLJNTCECJU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3)?

3-Amino-4-hydroxybenzenesulfonic acid, with the CAS number 98-37-3, is an organic compound containin...

Compound Q&A

Is 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) safe?

3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) is generally considered safe when handled prope...

Compound Q&A

How should 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) be stored?

3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) should be stored in a cool, dry, and well-venti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...