Compound Q&A

What is 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3)?

Answer

3-Amino-4-hydroxybenzenesulfonic acid
3-Amino-4-hydroxybenzenesulfonic acid, with the CAS number 98-37-3, is an organic compound containing an amino group, a hydroxyl group, and a sulfonic acid group attached to a benzene ring. It is commonly used as an intermediate in the synthesis of various pharmaceuticals and dyes. Its chemical formula is C7H9NO5S, and it is a white crystalline solid that is soluble in water.

About

CAS No 98-37-3
English Name 3-Amino-4-hydroxybenzenesulfonic acid
Molecular Formula C6H7NO4S
Molecular Weight 189.19 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)O
InChIKey ULUIMLJNTCECJU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3)?

3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) is primarily used in pharmaceuticals as a precu...

Compound Q&A

Is 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) safe?

3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) is generally considered safe when handled prope...

Compound Q&A

How should 3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) be stored?

3-Amino-4-hydroxybenzenesulfonic acid (CAS: 98-37-3) should be stored in a cool, dry, and well-venti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...