Compound Q&A

What are the main uses of Diisononyl Phthalate (CAS: 28553-12-0)?

Answer

Diisononyl Phthalate
Diisononyl Phthalate (CAS: 28553-12-0) is primarily used as a plasticizer in the production of polyvinyl chloride (PVC) products. It is also found in adhesives, sealants, and coatings. Additionally, it has applications in pharmaceuticals and research due to its chemical versatility and compatibility with various materials.

About

CAS No 28553-12-0
English Name Diisononyl Phthalate
Molecular Formula C26H42O4
Molecular Weight 418.6 g/mol
SMILES CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C
InChIKey HBGGXOJOCNVPFY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Diisononyl Phthalate (CAS: 28553-12-0)?

Diisononyl Phthalate (CAS: 28553-12-0) is a chemical compound commonly used as a plasticizer. It has...

Compound Q&A

Is Diisononyl Phthalate (CAS: 28553-12-0) safe?

Diisononyl Phthalate (CAS: 28553-12-0) is generally considered safe when used properly, but it may p...

Compound Q&A

How should Diisononyl Phthalate (CAS: 28553-12-0) be stored?

Diisononyl Phthalate (CAS: 28553-12-0) should be stored in a cool, dry, and well-ventilated place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...