Compound Q&A

What is Diisononyl Phthalate (CAS: 28553-12-0)?

Answer

Diisononyl Phthalate
Diisononyl Phthalate (CAS: 28553-12-0) is a chemical compound commonly used as a plasticizer. It has the chemical formula C24H44O4 and is a clear, colorless liquid with low volatility. It is known for its good flexibility and stability properties, making it suitable for various industrial applications.

About

CAS No 28553-12-0
English Name Diisononyl Phthalate
Molecular Formula C26H42O4
Molecular Weight 418.6 g/mol
SMILES CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C
InChIKey HBGGXOJOCNVPFY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Diisononyl Phthalate (CAS: 28553-12-0)?

Diisononyl Phthalate (CAS: 28553-12-0) is primarily used as a plasticizer in the production of polyv...

Compound Q&A

Is Diisononyl Phthalate (CAS: 28553-12-0) safe?

Diisononyl Phthalate (CAS: 28553-12-0) is generally considered safe when used properly, but it may p...

Compound Q&A

How should Diisononyl Phthalate (CAS: 28553-12-0) be stored?

Diisononyl Phthalate (CAS: 28553-12-0) should be stored in a cool, dry, and well-ventilated place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...