Compound Q&A

How should 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) be stored?

Answer

3-Carboxy-1-methylpyridinium chloride
3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) should be stored in a cool, dry, and well-ventilated place, away from light and moisture. It is typically kept in a sealed container at room temperature (15-25°C) to maintain stability and prevent degradation. Avoid exposure to incompatible materials and ensure proper labeling for safe handling.

About

CAS No 6138-41-6
English Name 3-Carboxy-1-methylpyridinium chloride
Molecular Formula C7H8ClNO2
Molecular Weight 173.6 g/mol
SMILES C[N+]1=CC=CC(=C1)C(=O)O.[Cl-]
InChIKey TZSYLWAXZMNUJB-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6)?

3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) is a quaternary ammonium compound with the ch...

Compound Q&A

What are the main uses of 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6)?

3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) is primarily used in pharmaceutical synthesis...

Compound Q&A

Is 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) safe?

3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) is generally considered safe when handled pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...