Compound Q&A

What are the main uses of 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6)?

Answer

3-Carboxy-1-methylpyridinium chloride
3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) is primarily used in pharmaceutical synthesis, particularly in the development of antifungal and antiviral drugs. It also serves as an intermediate in the production of pesticides, dyes, and other organic compounds, and is valuable in chemical research for its reactivity and functional group versatility.

About

CAS No 6138-41-6
English Name 3-Carboxy-1-methylpyridinium chloride
Molecular Formula C7H8ClNO2
Molecular Weight 173.6 g/mol
SMILES C[N+]1=CC=CC(=C1)C(=O)O.[Cl-]
InChIKey TZSYLWAXZMNUJB-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6)?

3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) is a quaternary ammonium compound with the ch...

Compound Q&A

Is 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) safe?

3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) is generally considered safe when handled pro...

Compound Q&A

How should 3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) be stored?

3-Carboxy-1-methylpyridinium chloride (CAS: 6138-41-6) should be stored in a cool, dry, and well-ven...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...