Compound Q&A

What are the main uses of 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7)?

Answer

2,2'-(1,1-Cyclohexanediyl)diacetic acid
2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) is primarily used in pharmaceuticals as a ligand for metal ion chelation. It also serves in industrial processes, such as crosslinking agents for polymers, and in research for organic synthesis. Additionally, it may be employed in food preservation as a stabilizer and in environmental applications for heavy metal removal. Its versatility makes it valuable across multiple fields.

About

CAS No 4355-11-7
English Name 2,2'-(1,1-Cyclohexanediyl)diacetic acid
Molecular Formula C10H16O4
Molecular Weight 200.23 g/mol
SMILES C1CCC(CC1)(CC(=O)O)CC(=O)O
InChIKey YQPCHPBGAALCRT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7)?

2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) is a dicarboxylic acid with the chemical fo...

Compound Q&A

Is 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) safe?

2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) is generally considered safe when handled p...

Compound Q&A

How should 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) be stored?

2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) should be stored in a cool, dry place, away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...