Compound Q&A

What is 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7)?

Answer

2,2'-(1,1-Cyclohexanediyl)diacetic acid
2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) is a dicarboxylic acid with the chemical formula C12H18O6. It features two acetic acid groups connected by a cyclohexane bridge, making it a versatile chelating agent. The compound is typically a white solid, soluble in water, and exhibits stability under normal conditions. Its molecular structure allows it to bind metal ions effectively, contributing to its use in various industrial and research applications.

About

CAS No 4355-11-7
English Name 2,2'-(1,1-Cyclohexanediyl)diacetic acid
Molecular Formula C10H16O4
Molecular Weight 200.23 g/mol
SMILES C1CCC(CC1)(CC(=O)O)CC(=O)O
InChIKey YQPCHPBGAALCRT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7)?

2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) is primarily used in pharmaceuticals as a l...

Compound Q&A

Is 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) safe?

2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) is generally considered safe when handled p...

Compound Q&A

How should 2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) be stored?

2,2'-(1,1-Cyclohexanediyl)diacetic acid (CAS: 4355-11-7) should be stored in a cool, dry place, away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...