Compound Q&A

How should Fenofibrate EP Impurity B (CAS: 42017-89-0) be stored?

Answer

Fenofibrate EP Impurity B (Fenofibrate USP Related Compound B, Fenofibric Acid)
Fenofibrate EP Impurity B (CAS: 42017-89-0) should be stored in a cool, dry place away from direct light. It is best kept in a sealed, airtight container to maintain its stability. The recommended storage temperature is between 15°C and 25°C, with controlled humidity levels to prevent degradation.

About

CAS No 42017-89-0
English Name Fenofibrate EP Impurity B (Fenofibrate USP Related Compound B, Fenofibric Acid)
Molecular Formula C17H15ClO4
Molecular Weight 318.76 g/mol
SMILES CC(C)(C(=O)O)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl
InChIKey MQOBSOSZFYZQOK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Fenofibrate EP Impurity B (CAS: 42017-89-0)?

Fenofibrate EP Impurity B, also known as Fenofibric Acid, is a chemical compound with the CAS number...

Compound Q&A

What are the main uses of Fenofibrate EP Impurity B (CAS: 42017-89-0)?

Fenofibrate EP Impurity B (Fenofibric Acid) is primarily used in the pharmaceutical industry as an i...

Compound Q&A

Is Fenofibrate EP Impurity B (CAS: 42017-89-0) safe?

Fenofibrate EP Impurity B (Fenofibric Acid) is generally considered safe when handled properly, thou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...