Compound Q&A

Is Hygromycin B (CAS: 31282-04-9) safe?

Answer

Hygromycin B
Hygromycin B (CAS: 31282-04-9) is generally considered safe when used appropriately in controlled laboratory settings. However, it should be handled with care, as prolonged exposure may pose health risks. Protective measures such as gloves and proper ventilation are recommended when working with this compound.

About

CAS No 31282-04-9
English Name Hygromycin B
Molecular Formula C20H37N3O13
Molecular Weight 527.5 g/mol
SMILES CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)N
InChIKey GRRNUXAQVGOGFE-HUCHGKBZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Hygromycin B (CAS: 31282-04-9)?

Hygromycin B is an aminocoumarin antibiotic with the chemical formula C17H24N2O6. It is known for it...

Compound Q&A

What are the main uses of Hygromycin B (CAS: 31282-04-9)?

Hygromycin B (CAS: 31282-04-9) is primarily used as a research tool in molecular biology for selecti...

Compound Q&A

How should Hygromycin B (CAS: 31282-04-9) be stored?

Hygromycin B (CAS: 31282-04-9) should be stored in a cool, dry place away from direct light. It is t...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...