Compound Q&A

Is Hygromycin B (CAS: 31282-04-9) safe?

Answer

Hygromycin B
Hygromycin B (CAS: 31282-04-9) is generally considered safe when used appropriately in controlled laboratory settings. However, it should be handled with care, as prolonged exposure may pose health risks. Protective measures such as gloves and proper ventilation are recommended when working with this compound.

About

CAS No 31282-04-9
English Name Hygromycin B
Molecular Formula C20H37N3O13
Molecular Weight 527.5 g/mol
SMILES CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)N
InChIKey GRRNUXAQVGOGFE-HUCHGKBZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Hygromycin B (CAS: 31282-04-9)?

Hygromycin B is an aminocoumarin antibiotic with the chemical formula C17H24N2O6. It is known for it...

Compound Q&A

What are the main uses of Hygromycin B (CAS: 31282-04-9)?

Hygromycin B (CAS: 31282-04-9) is primarily used as a research tool in molecular biology for selecti...

Compound Q&A

How should Hygromycin B (CAS: 31282-04-9) be stored?

Hygromycin B (CAS: 31282-04-9) should be stored in a cool, dry place away from direct light. It is t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...