Compound Q&A

What are the main uses of Hygromycin B (CAS: 31282-04-9)?

Answer

Hygromycin B
Hygromycin B (CAS: 31282-04-9) is primarily used as a research tool in molecular biology for selecting and maintaining genetically modified cells. It is also applied in pharmaceutical development and as a natural antibiotic in certain agricultural and biotechnological contexts.

About

CAS No 31282-04-9
English Name Hygromycin B
Molecular Formula C20H37N3O13
Molecular Weight 527.5 g/mol
SMILES CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)N
InChIKey GRRNUXAQVGOGFE-HUCHGKBZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Hygromycin B (CAS: 31282-04-9)?

Hygromycin B is an aminocoumarin antibiotic with the chemical formula C17H24N2O6. It is known for it...

Compound Q&A

Is Hygromycin B (CAS: 31282-04-9) safe?

Hygromycin B (CAS: 31282-04-9) is generally considered safe when used appropriately in controlled la...

Compound Q&A

How should Hygromycin B (CAS: 31282-04-9) be stored?

Hygromycin B (CAS: 31282-04-9) should be stored in a cool, dry place away from direct light. It is t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...