Compound Q&A

What are the main uses of Hygromycin B (CAS: 31282-04-9)?

Answer

Hygromycin B
Hygromycin B (CAS: 31282-04-9) is primarily used as a research tool in molecular biology for selecting and maintaining genetically modified cells. It is also applied in pharmaceutical development and as a natural antibiotic in certain agricultural and biotechnological contexts.

About

CAS No 31282-04-9
English Name Hygromycin B
Molecular Formula C20H37N3O13
Molecular Weight 527.5 g/mol
SMILES CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)N
InChIKey GRRNUXAQVGOGFE-HUCHGKBZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Hygromycin B (CAS: 31282-04-9)?

Hygromycin B is an aminocoumarin antibiotic with the chemical formula C17H24N2O6. It is known for it...

Compound Q&A

Is Hygromycin B (CAS: 31282-04-9) safe?

Hygromycin B (CAS: 31282-04-9) is generally considered safe when used appropriately in controlled la...

Compound Q&A

How should Hygromycin B (CAS: 31282-04-9) be stored?

Hygromycin B (CAS: 31282-04-9) should be stored in a cool, dry place away from direct light. It is t...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...