Compound Q&A

How should Closantel sodium (CAS: 61438-64-0) be stored?

Answer

Closantel sodium
Closantel sodium (CAS: 61438-64-0) should be stored in a cool, dry place away from direct light. It is typically kept in airtight containers to prevent moisture absorption and maintain chemical stability. Proper storage conditions help preserve its efficacy and ensure safe handling over time.

About

CAS No 61438-64-0
English Name Closantel sodium
Molecular Formula C22H13Cl2I2N2NaO2
Molecular Weight 685.1 g/mol
SMILES CC1=CC(=C(C=C1NC(=O)C2=C(C(=CC(=C2)I)I)[O-])Cl)C(C#N)C3=CC=C(C=C3)Cl.[Na+]
InChIKey LREGMDNUOGTSIK-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Closantel sodium (CAS: 61438-64-0)?

Closantel sodium (CAS: 61438-64-0) is an anthelmintic compound used to treat parasitic infections in...

Compound Q&A

What are the main uses of Closantel sodium (CAS: 61438-64-0)?

Closantel sodium (CAS: 61438-64-0) is primarily used in veterinary medicine to control parasitic wor...

Compound Q&A

Is Closantel sodium (CAS: 61438-64-0) safe?

Closantel sodium (CAS: 61438-64-0) is generally considered safe when used as directed in veterinary ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...