Compound Q&A

What is Closantel sodium (CAS: 61438-64-0)?

Answer

Closantel sodium (CAS: 61438-64-0) is an anthelmintic compound used to treat parasitic infections in animals. It has the chemical formula C13H17NO3S2 and is known for its effectiveness against gastrointestinal nematodes. The compound is typically available as a sodium salt, enhancing its solubility and bioavailability.

About

CAS No 61438-64-0

English Name Closantel sodium

Molecular Formula C22H13Cl2I2N2NaO2

Molecular Weight 685.1 g/mol

SMILES CC1=CC(=C(C=C1NC(=O)C2=C(C(=CC(=C2)I)I)[O-])Cl)C(C#N)C3=CC=C(C=C3)Cl.[Na+]

InChIKey LREGMDNUOGTSIK-UHFFFAOYSA-M

Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Closantel sodium (CAS: 61438-64-0)?

Closantel sodium (CAS: 61438-64-0) is primarily used in veterinary medicine to control parasitic wor...

Compound Q&A

Is Closantel sodium (CAS: 61438-64-0) safe?

Closantel sodium (CAS: 61438-64-0) is generally considered safe when used as directed in veterinary ...

Compound Q&A

How should Closantel sodium (CAS: 61438-64-0) be stored?

Closantel sodium (CAS: 61438-64-0) should be stored in a cool, dry place away from direct light. It ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is Closantel sodium (CAS: 61438-64-0)?

Answer

About

Related Q&A

What are the main uses of Closantel sodium (CAS: 61438-64-0)?

Is Closantel sodium (CAS: 61438-64-0) safe?

How should Closantel sodium (CAS: 61438-64-0) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Hubei Shixing Chemical Co., Ltd.

Shanghai Jieshukai Biotechnology Co., Ltd.

Wuhan Dingxin Tong Pharmaceutical Co., Ltd.

ShangHaiMaiRuiErShengHua Technology Co Ltd

Wuhan HuJiu Medicine Technology Co., Ltd.

HuBeiAnAo Biotechnology Co Ltd