Compound Q&A

What is Fmoc-L-Leu-OH (CAS: 35661-60-0)?

Answer

Fmoc-L-Leu-OH
Fmoc-L-Leu-OH, or N-(9-Fluorenylmethoxycarbonyl)-L-leucine hydrochloride, is a protected amino acid derivative commonly used in peptide synthesis. Its chemical formula is C25H25ClNO4, and it is characterized by a hydroxyl group on the leucine side chain. The compound is known for its stability and solubility in aqueous solutions, making it a valuable reagent in chemical research and pharmaceutical development.

About

CAS No 35661-60-0
English Name Fmoc-L-Leu-OH
Molecular Formula C21H23NO4
Molecular Weight 353.42 g/mol
SMILES CC(C)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey CBPJQFCAFFNICX-IBGZPJMESA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Fmoc-L-Leu-OH (CAS: 35661-60-0)?

Fmoc-L-Leu-OH is primarily used in the synthesis of peptides and proteins, particularly in solid-pha...

Compound Q&A

Is Fmoc-L-Leu-OH (CAS: 35661-60-0) safe?

Fmoc-L-Leu-OH is generally considered safe when handled properly. However, it should be treated with...

Compound Q&A

How should Fmoc-L-Leu-OH (CAS: 35661-60-0) be stored?

Fmoc-L-Leu-OH should be stored in a cool, dry place away from light. It is best kept in a sealed con...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...