Compound Q&A

What is 3,3'-Disulfanediylbis(6-nitrobenzoic acid) (CAS: 69-78-3)?

Answer

3,3'-Disulfanediylbis(6-nitrobenzoic acid)
3,3'-Disulfanediylbis(6-nitrobenzoic acid), with CAS number 69-78-3, is a chemical compound featuring two 6-nitrobenzoic acid groups connected by a disulfane bridge. Its chemical formula is C14H10N2O4S2. The molecule is characterized by aromatic rings with nitro (NO2) and carboxylic acid (COOH) functional groups, and it is typically a solid at room temperature. It exhibits moderate solubility in polar organic solvents and is known for its stability under standard conditions.

About

CAS No 69-78-3
English Name 3,3'-Disulfanediylbis(6-nitrobenzoic acid)
Molecular Formula C14H8N2O8S2
Molecular Weight 396.4 g/mol
SMILES C1=CC(=C(C=C1SSC2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O)C(=O)O)[N+](=O)[O-]
InChIKey KIUMMUBSPKGMOY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3,3'-Disulfanediylbis(6-nitrobenzoic acid) (CAS: 69-78-3)?

3,3'-Disulfanediylbis(6-nitrobenzoic acid) (CAS: 69-78-3) is primarily used in pharmaceutical resear...

Compound Q&A

Is 3,3'-Disulfanediylbis(6-nitrobenzoic acid) (CAS: 69-78-3) safe?

3,3'-Disulfanediylbis(6-nitrobenzoic acid) (CAS: 69-78-3) requires careful handling due to potential...

Compound Q&A

How should 3,3'-Disulfanediylbis(6-nitrobenzoic acid) (CAS: 69-78-3) be stored?

3,3'-Disulfanediylbis(6-nitrobenzoic acid) (CAS: 69-78-3) should be stored in a cool, dry place (ide...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...