Compound Q&A

How should 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1) be stored?

Answer

2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
This compound should be stored in a cool, dry, and well-ventilated area away from direct light. It is typically kept in a sealed glass container at a temperature below 25°C. Maintaining low humidity levels is crucial to prevent degradation. Ensure proper labeling and store away from incompatible materials to maintain stability and safety.

About

English Name 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Molecular Formula C12H19NO5
Molecular Weight 257.29 g/mol
SMILES CCOC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C
InChIKey YWWWGFSJHCFVOW-QMMMGPOBSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1)?

2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1) is a synt...

Compound Q&A

What are the main uses of 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1)?

This compound is primarily used in pharmaceutical research for the synthesis of drug molecules, part...

Compound Q&A

Is 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1) safe?

The safety of 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...