Compound Q&A

Is 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1) safe?

Answer

2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
The safety of 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1) depends on its handling and exposure conditions. It is generally considered safe when used in controlled environments, but proper protective equipment such as gloves and goggles should be worn. Adherence to standard safety protocols and storage guidelines is essential to minimize risks.

About

English Name 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Molecular Formula C12H19NO5
Molecular Weight 257.29 g/mol
SMILES CCOC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C
InChIKey YWWWGFSJHCFVOW-QMMMGPOBSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1)?

2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1) is a synt...

Compound Q&A

What are the main uses of 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1)?

This compound is primarily used in pharmaceutical research for the synthesis of drug molecules, part...

Compound Q&A

How should 2-Ethyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 144978-12-1) be stored?

This compound should be stored in a cool, dry, and well-ventilated area away from direct light. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...