Compound Q&A

What is Bismuth(3+) citrate (CAS: 813-93-4)?

Answer

Bismuth(3+) citrate
Bismuth(3+) citrate is a coordination compound composed of bismuth ions and citrate ligands. It has the chemical formula Bi(C6H5O7)3·xH2O and is typically found in hydrated form. This compound is known for its low toxicity and is used in various applications due to its mild antacid properties and ability to form stable complexes.

About

CAS No 813-93-4
English Name Bismuth(3+) citrate
Molecular Formula C6H5BiO7
Molecular Weight 398.08 g/mol
SMILES [O-]C(=O)C(CC(=O)[O-])(CC(=O)[O-])O.[Bi+3]
InChIKey SBINOAIOGOUDOT-UHFFFAOYSA-K
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Bismuth(3+) citrate (CAS: 813-93-4)?

Bismuth(3+) citrate is primarily used in pharmaceuticals as an antacid and for treating gastrointest...

Compound Q&A

Is Bismuth(3+) citrate (CAS: 813-93-4) safe?

Bismuth(3+) citrate is generally considered safe when used as directed. It has low toxicity and is w...

Compound Q&A

How should Bismuth(3+) citrate (CAS: 813-93-4) be stored?

Bismuth(3+) citrate should be stored in a cool, dry, and dark place to maintain its stability. It is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...