Compound Q&A

What are the main uses of N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2)?

Answer

N-Acetyl-beta-alanyl-L-histidine
N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) is widely utilized in pharmaceuticals for developing antihistamine drugs and as a component in flavor enhancers. It also serves in research for studying amino acid derivatives and in industrial processes for producing specialized chemical compounds. Additionally, it may be used in nutritional supplements and as a buffer in biochemical applications.

About

CAS No 56353-15-2
English Name N-Acetyl-beta-alanyl-L-histidine
Molecular Formula C11H16N4O4
Molecular Weight 268.273 g/mol
EINECS 260-123-2
SMILES CC(=O)NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O
InChIKey BKAYIFDRRZZKNF-VIFPVBQESA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2)?

N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) is a histidine derivative used primarily in pharm...

Compound Q&A

Is N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) safe?

N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) is generally considered safe when handled accordi...

Compound Q&A

How should N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) be stored?

N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) should be stored in a cool, dry place (ideally 2-...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...