Compound Q&A

What is N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2)?

Answer

N-Acetyl-beta-alanyl-L-histidine
N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) is a histidine derivative used primarily in pharmaceutical and chemical applications. Its chemical formula is C12H17N5O4, and it exhibits solubility in water, making it suitable for use in drug formulations. This compound is known for its role as an intermediate in the synthesis of certain medications and its stability under controlled conditions.

About

CAS No 56353-15-2
English Name N-Acetyl-beta-alanyl-L-histidine
Molecular Formula C11H16N4O4
Molecular Weight 268.27 g/mol
EINECS 260-123-2
SMILES CC(=O)NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O
InChIKey BKAYIFDRRZZKNF-VIFPVBQESA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2)?

N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) is widely utilized in pharmaceuticals for develop...

Compound Q&A

Is N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) safe?

N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) is generally considered safe when handled accordi...

Compound Q&A

How should N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) be stored?

N-Acetyl-beta-alanyl-L-histidine (CAS: 56353-15-2) should be stored in a cool, dry place (ideally 2-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...