Compound Q&A

What are the main uses of 6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5)?

Answer

6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate
6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5) is primarily utilized in pharmaceuticals as a progestin precursor and in drug synthesis. It also finds applications in research for studying steroid hormone mechanisms and in the development of contraceptive or anti-inflammatory agents. Industrial uses include its role as a chemical intermediate in organic synthesis processes.

About

CAS No 595-33-5
English Name 6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate
Molecular Formula C24H32O4
Molecular Weight 384.5160000000002 g/mol
SMILES CC1=CC2C(CCC3(C2CCC3(C(=O)C)OC(=O)C)C)C4(C1=CC(=O)CC4)C
InChIKey RQZAXGRLVPAYTJ-GQFGMJRRSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5)?

6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5) is a synthetic steroid derivative w...

Compound Q&A

Is 6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5) safe?

6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5) is generally considered safe when h...

Compound Q&A

How should 6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5) be stored?

6-Methyl-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 595-33-5) should be stored in a cool, dry pla...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...