Compound Q&A

What are the main uses of (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6)?

Answer

(2S)-2-(4-Isobutylphenyl)propanoic acid
(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) is primarily used in pharmaceuticals as a building block for drug molecules, particularly in the synthesis of medications requiring chiral purity. It also finds applications in industrial chemistry for polymer production and as a flavoring or fragrance component. Researchers utilize it in studies related to organic synthesis and stereochemistry due to its structural versatility.

About

CAS No 51146-56-6
English Name (2S)-2-(4-Isobutylphenyl)propanoic acid
Molecular Formula C13H18O2
Molecular Weight 206.28 g/mol
SMILES CC(C)Cc1ccc(cc1)[C@H](C)C(=O)O
InChIKey HEFNNWSXXWATRW-JTQLQIEISA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6)?

(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) is a chiral organic compound with the chem...

Compound Q&A

Is (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) safe?

(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) is generally considered safe when handled ...

Compound Q&A

How should (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) be stored?

(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) should be stored in a cool, dry place, pre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...