Compound Q&A

What is (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6)?

Answer

(2S)-2-(4-Isobutylphenyl)propanoic acid
(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) is a chiral organic compound with the chemical formula C13H18O2. It is a key intermediate in pharmaceutical and chemical synthesis, characterized by its branched alkyl groups and carboxylic acid functional group. The compound exhibits specific stereochemical properties, making it valuable in the development of enantiomerically pure drugs and materials.

About

CAS No 51146-56-6
English Name (2S)-2-(4-Isobutylphenyl)propanoic acid
Molecular Formula C13H18O2
Molecular Weight 206.28 g/mol
SMILES CC(C)Cc1ccc(cc1)[C@H](C)C(=O)O
InChIKey HEFNNWSXXWATRW-JTQLQIEISA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6)?

(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) is primarily used in pharmaceuticals as a ...

Compound Q&A

Is (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) safe?

(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) is generally considered safe when handled ...

Compound Q&A

How should (2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) be stored?

(2S)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-56-6) should be stored in a cool, dry place, pre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...