Compound Q&A

How should dipsacoside B (CAS: 33289-85-9) be stored?

Answer

dipsacoside B
Dipsacoside B should be stored in a cool, dry, and dark place to maintain its stability and prevent degradation. It is recommended to keep it in a sealed container away from moisture and light exposure. Storage at temperatures below 25°C and in a controlled humidity environment is optimal for preserving its chemical integrity.

About

CAS No 33289-85-9
English Name dipsacoside B
Molecular Formula C53H86O22
Molecular Weight 1075.249000000001 g/mol
SMILES CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)C2(C)CO)C(O)C(O)C1O
InChIKey GFPLPBCJRRNZHM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is dipsacoside B (CAS: 33289-85-9)?

Dipsacoside B is a natural compound with the chemical formula C25H44O12. It is a type of triterpene ...

Compound Q&A

What are the main uses of dipsacoside B (CAS: 33289-85-9)?

Dipsacoside B is primarily used in pharmaceutical research for its potential therapeutic application...

Compound Q&A

Is dipsacoside B (CAS: 33289-85-9) safe?

Dipsacoside B is generally considered safe when used under controlled conditions. However, as with a...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...