Compound Q&A

How should dipsacoside B (CAS: 33289-85-9) be stored?

Answer

dipsacoside B
Dipsacoside B should be stored in a cool, dry, and dark place to maintain its stability and prevent degradation. It is recommended to keep it in a sealed container away from moisture and light exposure. Storage at temperatures below 25°C and in a controlled humidity environment is optimal for preserving its chemical integrity.

About

CAS No 33289-85-9
English Name dipsacoside B
Molecular Formula C53H86O22
Molecular Weight 1075.25 g/mol
SMILES CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)C2(C)CO)C(O)C(O)C1O
InChIKey GFPLPBCJRRNZHM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is dipsacoside B (CAS: 33289-85-9)?

Dipsacoside B is a natural compound with the chemical formula C25H44O12. It is a type of triterpene ...

Compound Q&A

What are the main uses of dipsacoside B (CAS: 33289-85-9)?

Dipsacoside B is primarily used in pharmaceutical research for its potential therapeutic application...

Compound Q&A

Is dipsacoside B (CAS: 33289-85-9) safe?

Dipsacoside B is generally considered safe when used under controlled conditions. However, as with a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...