Compound Q&A

Is dipsacoside B (CAS: 33289-85-9) safe?

Answer

dipsacoside B
Dipsacoside B is generally considered safe when used under controlled conditions. However, as with any chemical compound, proper handling is essential to avoid skin or eye contact. Safety data suggests it has low toxicity, but further research is needed to fully establish its safety profile in long-term use and human applications.

About

CAS No 33289-85-9
English Name dipsacoside B
Molecular Formula C53H86O22
Molecular Weight 1075.249000000001 g/mol
SMILES CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)C2(C)CO)C(O)C(O)C1O
InChIKey GFPLPBCJRRNZHM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is dipsacoside B (CAS: 33289-85-9)?

Dipsacoside B is a natural compound with the chemical formula C25H44O12. It is a type of triterpene ...

Compound Q&A

What are the main uses of dipsacoside B (CAS: 33289-85-9)?

Dipsacoside B is primarily used in pharmaceutical research for its potential therapeutic application...

Compound Q&A

How should dipsacoside B (CAS: 33289-85-9) be stored?

Dipsacoside B should be stored in a cool, dry, and dark place to maintain its stability and prevent ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...