Compound Q&A

Is Risedronic acid sodium (CAS: 115436-72-1) safe?

Answer

Risedronic acid sodium
Risedronic acid sodium (CAS: 115436-72-1) is generally safe when used as prescribed, but it may cause gastrointestinal side effects. Safety standards emphasize proper handling, such as wearing gloves and avoiding ingestion, to minimize risks. Long-term use should be monitored for potential adverse effects, and adherence to medical guidelines is crucial for safe application.

About

English Name Risedronic acid sodium
Molecular Formula C7H10NNaO7P2
Molecular Weight 305.09 g/mol
SMILES C1=CC(=CN=C1)CC(O)(P(=O)(O)O)P(=O)(O)[O-].[Na+]
InChIKey DRFDPXKCEWYIAW-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Risedronic acid sodium (CAS: 115436-72-1)?

Risedronic acid sodium (CAS: 115436-72-1) is a bisphosphonate compound used primarily in pharmaceuti...

Compound Q&A

What are the main uses of Risedronic acid sodium (CAS: 115436-72-1)?

Risedronic acid sodium (CAS: 115436-72-1) is mainly used as a medication for osteoporosis treatment,...

Compound Q&A

How should Risedronic acid sodium (CAS: 115436-72-1) be stored?

Risedronic acid sodium (CAS: 115436-72-1) should be stored in a cool, dry place at 2-8°C, protected ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...