Compound Q&A

What is Risedronic acid sodium (CAS: 115436-72-1)?

Answer

Risedronic acid sodium
Risedronic acid sodium (CAS: 115436-72-1) is a bisphosphonate compound used primarily in pharmaceuticals. Its chemical formula is C13H19N3O10P2Na, and it exhibits high solubility in water. This compound is known for its ability to inhibit bone resorption, making it effective in treating osteoporosis and other bone-related conditions.

About

English Name Risedronic acid sodium
Molecular Formula C7H10NNaO7P2
Molecular Weight 305.09 g/mol
SMILES C1=CC(=CN=C1)CC(O)(P(=O)(O)O)P(=O)(O)[O-].[Na+]
InChIKey DRFDPXKCEWYIAW-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Risedronic acid sodium (CAS: 115436-72-1)?

Risedronic acid sodium (CAS: 115436-72-1) is mainly used as a medication for osteoporosis treatment,...

Compound Q&A

Is Risedronic acid sodium (CAS: 115436-72-1) safe?

Risedronic acid sodium (CAS: 115436-72-1) is generally safe when used as prescribed, but it may caus...

Compound Q&A

How should Risedronic acid sodium (CAS: 115436-72-1) be stored?

Risedronic acid sodium (CAS: 115436-72-1) should be stored in a cool, dry place at 2-8°C, protected ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...