Compound Q&A

What are the main uses of 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0)?

Answer

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione
3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) is primarily used in pharmaceutical research as a precursor for the synthesis of various nucleoside analogs. It also finds applications in organic chemistry for the development of new compounds and in the study of nucleotide metabolism. Its utility extends to biochemical research and drug discovery processes.

About

CAS No 83-67-0
English Name 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione
Molecular Formula C7H8N4O2
Molecular Weight 180.17 g/mol
SMILES Cn1cnc2n(C)c(=O)[nH]c(=O)c12
InChIKey YAPQBXQYLJRXSA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0)?

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) is a purine derivative with the chemical...

Compound Q&A

Is 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) safe?

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) is generally considered safe when handle...

Compound Q&A

How should 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) be stored?

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) should be stored in a cool, dry, and dar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...