Compound Q&A

What is 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0)?

Answer

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione
3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) is a purine derivative with the chemical formula C8H10N4O2. It is a white solid that is typically used in chemical synthesis. The compound exhibits moderate solubility in water and organic solvents. It is known for its structural similarity to nucleotides and is often studied for its potential biological activities.

About

CAS No 83-67-0
English Name 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione
Molecular Formula C7H8N4O2
Molecular Weight 180.17 g/mol
SMILES Cn1cnc2n(C)c(=O)[nH]c(=O)c12
InChIKey YAPQBXQYLJRXSA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0)?

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) is primarily used in pharmaceutical rese...

Compound Q&A

Is 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) safe?

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) is generally considered safe when handle...

Compound Q&A

How should 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) be stored?

3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 83-67-0) should be stored in a cool, dry, and dar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...