Compound Q&A

What are the main uses of (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9)?

Answer

(3beta,12beta)-Dammar-24-ene-3,12,20-triol
(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) is primarily utilized in pharmaceutical research for its potential anti-inflammatory and antitumor properties. It also serves as a precursor in the synthesis of other bioactive compounds and is employed in industrial and cosmetic formulations due to its stability and versatility. Additionally, it is studied in medicinal chemistry for drug development and biological activity exploration.

About

CAS No 30636-90-9
English Name (3beta,12beta)-Dammar-24-ene-3,12,20-triol
Molecular Formula C30H52O3
Molecular Weight 460.74 g/mol
SMILES CC(C)=CCC[C@](C)(O)[C@H]1CC[C@]2(C)[C@@H]1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3CC[C@@]21C
InChIKey PYXFVCFISTUSOO-HKUCOEKDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9)?

(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) is a triterpene compound with the chemi...

Compound Q&A

Is (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) safe?

(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) is generally considered safe when handl...

Compound Q&A

How should (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) be stored?

(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) should be stored in a sealed, airtight ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...