Compound Q&A

What is (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9)?

Answer

(3beta,12beta)-Dammar-24-ene-3,12,20-triol
(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) is a triterpene compound with the chemical formula C30H48O3. It features three hydroxyl groups at positions 3, 12, and 20, and exhibits a unique stereochemistry (3β,12β). This compound is known for its potential biological activities and is commonly used in research and pharmaceutical applications due to its structural complexity and reactivity.

About

CAS No 30636-90-9
English Name (3beta,12beta)-Dammar-24-ene-3,12,20-triol
Molecular Formula C30H52O3
Molecular Weight 460.74 g/mol
SMILES CC(C)=CCC[C@](C)(O)[C@H]1CC[C@]2(C)[C@@H]1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3CC[C@@]21C
InChIKey PYXFVCFISTUSOO-HKUCOEKDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9)?

(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) is primarily utilized in pharmaceutical...

Compound Q&A

Is (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) safe?

(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) is generally considered safe when handl...

Compound Q&A

How should (3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) be stored?

(3beta,12beta)-Dammar-24-ene-3,12,20-triol (CAS: 30636-90-9) should be stored in a sealed, airtight ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...