Compound Q&A

What are the main uses of 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0)?

Answer

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid
5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) is primarily used in pharmaceutical research as a potential precursor for drug development. It also finds applications in industrial processes, particularly in the synthesis of surfactants and coatings. Its unique structure makes it valuable in organic chemistry for creating derivatives with tailored properties.

About

CAS No 25812-30-0
English Name 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid
Molecular Formula C15H22O3
Molecular Weight 250.34 g/mol
SMILES Cc1ccc(C)c(OCCCC(C)(C)C(=O)O)c1
InChIKey HEMJJKBWTPKOJG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0)?

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) is an organic compound characte...

Compound Q&A

Is 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) safe?

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) is generally considered safe wh...

Compound Q&A

How should 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) be stored?

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...