Compound Q&A

What is 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0)?

Answer

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid
5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) is an organic compound characterized by its long hydrocarbon chain and aromatic substituents. It has the chemical formula C17H26O3 and is known for its stability under normal conditions. This compound exhibits moderate solubility in organic solvents and is commonly used in various chemical applications due to its structural versatility.

About

CAS No 25812-30-0
English Name 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid
Molecular Formula C15H22O3
Molecular Weight 250.34 g/mol
SMILES Cc1ccc(C)c(OCCCC(C)(C)C(=O)O)c1
InChIKey HEMJJKBWTPKOJG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0)?

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) is primarily used in pharmaceut...

Compound Q&A

Is 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) safe?

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) is generally considered safe wh...

Compound Q&A

How should 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) be stored?

5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid (CAS: 25812-30-0) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...