Compound Q&A

What are the main uses of 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3)?

Answer

2-Amino-1-naphthalenesulfonic acid
2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) is primarily used in the pharmaceutical industry for the synthesis of drugs and as a building block in organic chemistry. It also finds applications in the production of dyes, pigments, and other specialty chemicals. In research settings, it is used for various chemical reactions and as a precursor for more complex molecules. Additionally, it may be used in the food industry as a flavor enhancer or in the development of food additives.

About

CAS No 81-16-3
English Name 2-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=C2S(=O)(=O)O)N
InChIKey GWIAAIUASRVOIA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3)?

2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) is an organic compound with the chemical formula C...

Compound Q&A

Is 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) safe?

2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) is generally considered safe when handled properly...

Compound Q&A

How should 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) be stored?

2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) should be stored in a cool, dry, and well-ventilat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...