Compound Q&A

What is 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3)?

Answer

2-Amino-1-naphthalenesulfonic acid
2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) is an organic compound with the chemical formula C10H9NO3S. It is a white crystalline solid that is commonly used in the synthesis of various chemical products. The compound is known for its acidic properties and is often found in the form of its sodium salt. It is also referred to as naphthalene sulfonic acid monoamide.

About

CAS No 81-16-3
English Name 2-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=C2S(=O)(=O)O)N
InChIKey GWIAAIUASRVOIA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3)?

2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) is primarily used in the pharmaceutical industry f...

Compound Q&A

Is 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) safe?

2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) is generally considered safe when handled properly...

Compound Q&A

How should 2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) be stored?

2-Amino-1-naphthalenesulfonic acid (CAS: 81-16-3) should be stored in a cool, dry, and well-ventilat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...