Compound Q&A

How should Cryptochlorogenic acid (CAS: 905-99-7) be stored?

Answer

Cryptochlorogenic acid
Cryptochlorogenic acid should be stored in a cool, dry, and dark place to maintain its stability and prevent degradation. It is typically kept in airtight containers to protect from moisture and light exposure. Storage at temperatures below 25°C and humidity levels below 60% is recommended to ensure product integrity.

About

CAS No 905-99-7
English Name Cryptochlorogenic acid
Molecular Formula C16H18O9
Molecular Weight 354.31 g/mol
SMILES C1C(C(C(CC1(C(=O)O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O
InChIKey GYFFKZTYYAFCTR-JUHZACGLSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Cryptochlorogenic acid (CAS: 905-99-7)?

Cryptochlorogenic acid is a naturally occurring hydroxycinnamic acid derivative found in various pla...

Compound Q&A

What are the main uses of Cryptochlorogenic acid (CAS: 905-99-7)?

Cryptochlorogenic acid is primarily used in pharmaceuticals for its potential health benefits, inclu...

Compound Q&A

Is Cryptochlorogenic acid (CAS: 905-99-7) safe?

Cryptochlorogenic acid is generally considered safe when used in appropriate amounts. It has low tox...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...