Compound Q&A

What is Cryptochlorogenic acid (CAS: 905-99-7)?

Answer

Cryptochlorogenic acid
Cryptochlorogenic acid is a naturally occurring hydroxycinnamic acid derivative found in various plants. Its chemical formula is C16H18O9, and it is known for its antioxidant and anti-inflammatory properties. It is a yellowish solid with a molecular weight of 354.31 g/mol and is commonly used in research and food-related applications.

About

CAS No 905-99-7
English Name Cryptochlorogenic acid
Molecular Formula C16H18O9
Molecular Weight 354.3110000000001 g/mol
SMILES C1C(C(C(CC1(C(=O)O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O
InChIKey GYFFKZTYYAFCTR-JUHZACGLSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Cryptochlorogenic acid (CAS: 905-99-7)?

Cryptochlorogenic acid is primarily used in pharmaceuticals for its potential health benefits, inclu...

Compound Q&A

Is Cryptochlorogenic acid (CAS: 905-99-7) safe?

Cryptochlorogenic acid is generally considered safe when used in appropriate amounts. It has low tox...

Compound Q&A

How should Cryptochlorogenic acid (CAS: 905-99-7) be stored?

Cryptochlorogenic acid should be stored in a cool, dry, and dark place to maintain its stability and...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...