Compound Q&A

How should 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) be stored?

Answer

4-Methyl-3-nitrobenzoic acid
4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) should be stored in a cool, dry place, away from light and moisture. Keep it in a sealed, airtight container, preferably made of glass or polyethylene, to maintain stability. Storage conditions should avoid temperatures above 25°C and ensure proper ventilation to prevent degradation or hazardous reactions.

About

CAS No 96-98-0
English Name 4-Methyl-3-nitrobenzoic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey BBEWSMNRCUXQRF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0)?

4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) is an organic compound with the chemical formula C8H7NO4...

Compound Q&A

What are the main uses of 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0)?

4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) is primarily used in pharmaceutical research as a precur...

Compound Q&A

Is 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) safe?

4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) requires careful handling due to its potential toxicity....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...