Compound Q&A

What is 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0)?

Answer

4-Methyl-3-nitrobenzoic acid
4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) is an organic compound with the chemical formula C8H7NO4. It features a benzene ring substituted with a methyl group, a nitro group, and a carboxylic acid group. This compound is known for its acidic properties and is commonly used in chemical synthesis. Its molecular structure makes it relevant in pharmaceutical and industrial applications.

About

CAS No 96-98-0
English Name 4-Methyl-3-nitrobenzoic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey BBEWSMNRCUXQRF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0)?

4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) is primarily used in pharmaceutical research as a precur...

Compound Q&A

Is 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) safe?

4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) requires careful handling due to its potential toxicity....

Compound Q&A

How should 4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) be stored?

4-Methyl-3-nitrobenzoic acid (CAS: 96-98-0) should be stored in a cool, dry place, away from light a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...