Compound Q&A

What are the main uses of 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7)?

Answer

2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid
This compound is primarily used in pharmaceutical research for developing drugs with potential therapeutic applications. It also serves as an intermediate in the synthesis of azo dyes and other organic compounds. Its unique structure makes it valuable in studying molecular interactions and chemical reactivity in research settings.

About

CAS No 493-52-7
English Name 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid
Molecular Formula C15H15N3O2
Molecular Weight 269.3 g/mol
SMILES CN(C)c1ccc(N=Nc2ccccc2C(=O)O)cc1
InChIKey CEQFOVLGLXCDCX-WUKNDPDISA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7)?

2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) is an organic compound featuri...

Compound Q&A

Is 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) safe?

The safety of 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) depends on its h...

Compound Q&A

How should 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) be stored?

2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...