Compound Q&A

What is 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7)?

Answer

2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid
2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) is an organic compound featuring a benzoic acid group connected to an azo group, which is linked to a dimethylamino-substituted phenyl ring. It is known for its conjugated structure and potential applications in chemical research and pharmaceutical development. The compound is typically used as an intermediate in the synthesis of various dyes and drugs.

About

CAS No 493-52-7
English Name 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid
Molecular Formula C15H15N3O2
Molecular Weight 269.3 g/mol
SMILES CN(C)c1ccc(N=Nc2ccccc2C(=O)O)cc1
InChIKey CEQFOVLGLXCDCX-WUKNDPDISA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7)?

This compound is primarily used in pharmaceutical research for developing drugs with potential thera...

Compound Q&A

Is 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) safe?

The safety of 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) depends on its h...

Compound Q&A

How should 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) be stored?

2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 493-52-7) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...