Compound Q&A

How should 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) be stored?

Answer

8-Amino-1-naphthalenesulfonic acid
8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) should be stored in a cool, dry, and dark environment to maintain stability. It is hygroscopic, requiring sealed containers to prevent moisture absorption. Storage below 25°C is recommended, and exposure to air or light should be minimized. Keep away from incompatible materials and ensure proper labeling to comply with chemical storage safety standards.

About

CAS No 82-75-7
English Name 8-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C(=C1)N)C(=CC=C2)S(=O)(=O)O
InChIKey CYJJLCDCWVZEDZ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7)?

8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) is an organic compound with the chemical formula C...

Compound Q&A

What are the main uses of 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7)?

8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) is primarily used in pharmaceuticals as an interme...

Compound Q&A

Is 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) safe?

8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) is generally considered safe when handled properly...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...