Compound Q&A

What is 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7)?

Answer

8-Amino-1-naphthalenesulfonic acid
8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) is an organic compound with the chemical formula C10H11NO4S. It is a white crystalline solid, known for its acidic properties due to the sulfonic group. Commonly used as a precursor in the synthesis of dyes, pharmaceuticals, and other chemical compounds, it exhibits solubility in water and organic solvents. Its structure combines an amino group with a naphthalene ring and sulfonic acid functional group, making it valuable in various industrial and research applications.

About

CAS No 82-75-7
English Name 8-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C(=C1)N)C(=CC=C2)S(=O)(=O)O
InChIKey CYJJLCDCWVZEDZ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7)?

8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) is primarily used in pharmaceuticals as an interme...

Compound Q&A

Is 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) safe?

8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) is generally considered safe when handled properly...

Compound Q&A

How should 8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) be stored?

8-Amino-1-naphthalenesulfonic acid (CAS: 82-75-7) should be stored in a cool, dry, and dark environm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...