Compound Q&A

What is Econazole nitrate (CAS: 24169-02-6)?

Answer

Econazole nitrate is an antifungal medication with the chemical formula C17H17N3O4S. It is a white to pale yellow powder that is soluble in water and commonly used in topical formulations. The compound is known for its broad-spectrum antifungal activity and is often found in over-the-counter creams and lotions for treating fungal infections.

About

CAS No 24169-02-6

English Name Econazole nitrate

Molecular Formula C18H15Cl3N2O.HNO3

Molecular Weight 444.7 g/mol

SMILES C1=CC(=CC=C1COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-]

InChIKey DDXORDQKGIZAME-UHFFFAOYSA-N

Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Econazole nitrate (CAS: 24169-02-6)?

Econazole nitrate is primarily used in the treatment of fungal infections such as athlete's foot, jo...

Compound Q&A

Is Econazole nitrate (CAS: 24169-02-6) safe?

Econazole nitrate is generally considered safe when used as directed, with low toxicity in topical a...

Compound Q&A

How should Econazole nitrate (CAS: 24169-02-6) be stored?

Econazole nitrate should be stored in a cool, dry place away from direct light. It is stable under n...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is Econazole nitrate (CAS: 24169-02-6)?

Answer

About

Related Q&A

What are the main uses of Econazole nitrate (CAS: 24169-02-6)?

Is Econazole nitrate (CAS: 24169-02-6) safe?

How should Econazole nitrate (CAS: 24169-02-6) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

ShenZhenShiZhongFaYuan Biotechnology Co Ltd

Shanghai Yinxin Laboratory Equipment Co., Ltd.

Zhejiang Chemical Industry Technology Group Co., Ltd.

MedChemExpress LLC

AiBiXin （ ShangHai ） Biotechnology Co Ltd

Shanghai Jixiang Biotechnology Co., Ltd.