Compound Q&A

How should (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8) be stored?

Answer

(4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one
This compound should be stored in a cool, dry place, away from light, in a sealed container to prevent moisture absorption. It is stable under standard storage conditions but may degrade if exposed to high humidity or air. Maintain proper storage to ensure chemical integrity and safety, especially when handling sensitive functional groups like oxazolidinone.

About

English Name (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one
Molecular Formula C16H21N3O2
Molecular Weight 287.36 g/mol
SMILES CN(C)CCC1=CNC2=C1C=C(C=C2)CC3COC(=O)N3
InChIKey ULSDMUVEXKOYBU-ZDUSSCGKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8)?

This compound, with the CAS number 139264-17-8, is a synthetic organic molecule containing an indole...

Compound Q&A

What are the main uses of (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8)?

The compound is primarily utilized in pharmaceutical research for developing drugs targeting neurolo...

Compound Q&A

Is (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8) safe?

Safety data for this compound is limited, but it is generally considered low toxicity when handled p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...