Compound Q&A

What is (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8)?

Answer

(4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one
This compound, with the CAS number 139264-17-8, is a synthetic organic molecule containing an indole ring, a dimethylaminoethyl group, and an oxazolidinone moiety. It is characterized by its complex structure, which includes stereochemical features (4S configuration) and functional groups such as amide and lactam. It is commonly used as a pharmaceutical intermediate due to its ability to modulate biological activity through molecular interactions.

About

English Name (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one
Molecular Formula C16H21N3O2
Molecular Weight 287.36 g/mol
SMILES CN(C)CCC1=CNC2=C1C=C(C=C2)CC3COC(=O)N3
InChIKey ULSDMUVEXKOYBU-ZDUSSCGKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8)?

The compound is primarily utilized in pharmaceutical research for developing drugs targeting neurolo...

Compound Q&A

Is (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8) safe?

Safety data for this compound is limited, but it is generally considered low toxicity when handled p...

Compound Q&A

How should (4S)-4-({3-[2-(Dimethylamino)ethyl]-1H-indol-5-yl}methyl)-1,3-oxazolidin-2-one (CAS: 139264-17-8) be stored?

This compound should be stored in a cool, dry place, away from light, in a sealed container to preve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...