Compound Q&A

How should (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) be stored?

Answer

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate
(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) should be stored in a cool, dry, and well-ventilated area, away from direct light. It is typically kept in a sealed, airtight container to prevent moisture absorption and degradation. Storage should also follow recommended conditions based on the specific safety data sheet (SDS) to maintain chemical stability and safety.

About

CAS No 7534-94-3
English Name (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate
Molecular Formula C14H22O2
Molecular Weight 222.33 g/mol
SMILES CC(C(O[C@H]1[C@](C2(C)C)(C)CC[C@]2([H])C1)=O)=C
InChIKey IAXXETNIOYFMLW-WDMOLILDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3)?

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) is an organic compo...

Compound Q&A

What are the main uses of (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3)?

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) is primarily used i...

Compound Q&A

Is (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) safe?

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) is generally consid...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...