Compound Q&A

What are the main uses of (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3)?

Answer

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate
(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) is primarily used in pharmaceutical and polymer industries. It serves as a building block for synthesizing various drug molecules and is also employed in the production of specialty polymers due to its unique structural properties and reactivity.

About

CAS No 7534-94-3
English Name (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate
Molecular Formula C14H22O2
Molecular Weight 222.33 g/mol
SMILES CC(C(O[C@H]1[C@](C2(C)C)(C)CC[C@]2([H])C1)=O)=C
InChIKey IAXXETNIOYFMLW-WDMOLILDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3)?

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) is an organic compo...

Compound Q&A

Is (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) safe?

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) is generally consid...

Compound Q&A

How should (1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) be stored?

(1R,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl methacrylate (CAS: 7534-94-3) should be stored in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...